About octyl 3-anilinopropanoate
octyl 3-anilinopropanoate (PubChem CID 63541566) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is octyl 3-anilinopropanoate.
Molecular Properties
| Compound Name | octyl 3-anilinopropanoate |
| PubChem CID | 63541566 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | octyl 3-anilinopropanoate |
| SMILES | CCCCCCCCOC(=O)CCNc1ccccc1 |
| InChI | InChI=1S/C17H27NO2/c1-2-3-4-5-6-10-15-20-17(19)13-14-18-16-11-8-7-9-12-16/h7-9,11-12,18H,2-6,10,13-15H2,1H3 |
| InChIKey | QSNUWNWYVUHPLC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octyl 3-anilinopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 3-anilinopropanoate?
The IUPAC name of octyl 3-anilinopropanoate (CID 63541566) is octyl 3-anilinopropanoate.
What is the SMILES notation for octyl 3-anilinopropanoate?
The canonical SMILES for octyl 3-anilinopropanoate is CCCCCCCCOC(=O)CCNc1ccccc1.
What is the InChIKey of octyl 3-anilinopropanoate?
The InChIKey is QSNUWNWYVUHPLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2/c1-2-3-4-5-6-10-15-20-17(19)13-14-18-16-11-8-7-9-12-16/h7-9,11-12,18H,2-6,10,13-15H2,1H3.
What are the key properties of octyl 3-anilinopropanoate?
octyl 3-anilinopropanoate has a molecular weight of 277.41 g/mol, XLogP of 4.39, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 3-anilinopropanoate is sourced from PubChem (CID 63541566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).