About ethyl 3-anilinopropanoate
ethyl 3-anilinopropanoate (PubChem CID 10910393) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is ethyl 3-anilinopropanoate.
Molecular Properties
| Compound Name | ethyl 3-anilinopropanoate |
| PubChem CID | 10910393 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethyl 3-anilinopropanoate |
| SMILES | CCOC(=O)CCNc1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-14-11(13)8-9-12-10-6-4-3-5-7-10/h3-7,12H,2,8-9H2,1H3 |
| InChIKey | TXEPQFCHHDFYMO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-anilinopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-anilinopropanoate?
The IUPAC name of ethyl 3-anilinopropanoate (CID 10910393) is ethyl 3-anilinopropanoate.
What is the SMILES notation for ethyl 3-anilinopropanoate?
The canonical SMILES for ethyl 3-anilinopropanoate is CCOC(=O)CCNc1ccccc1.
What is the InChIKey of ethyl 3-anilinopropanoate?
The InChIKey is TXEPQFCHHDFYMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-14-11(13)8-9-12-10-6-4-3-5-7-10/h3-7,12H,2,8-9H2,1H3.
What are the key properties of ethyl 3-anilinopropanoate?
ethyl 3-anilinopropanoate has a molecular weight of 193.25 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-anilinopropanoate is sourced from PubChem (CID 10910393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).