About 2-(2-anilinoethoxy)ethyl butanoate
2-(2-anilinoethoxy)ethyl butanoate (PubChem CID 102065089) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(2-anilinoethoxy)ethyl butanoate.
Molecular Properties
| Compound Name | 2-(2-anilinoethoxy)ethyl butanoate |
| PubChem CID | 102065089 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-(2-anilinoethoxy)ethyl butanoate |
| SMILES | CCCC(=O)OCCOCCNc1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c1-2-6-14(16)18-12-11-17-10-9-15-13-7-4-3-5-8-13/h3-5,7-8,15H,2,6,9-12H2,1H3 |
| InChIKey | TVBXTYQIYYLSMU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-anilinoethoxy)ethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-anilinoethoxy)ethyl butanoate?
The IUPAC name of 2-(2-anilinoethoxy)ethyl butanoate (CID 102065089) is 2-(2-anilinoethoxy)ethyl butanoate.
What is the SMILES notation for 2-(2-anilinoethoxy)ethyl butanoate?
The canonical SMILES for 2-(2-anilinoethoxy)ethyl butanoate is CCCC(=O)OCCOCCNc1ccccc1.
What is the InChIKey of 2-(2-anilinoethoxy)ethyl butanoate?
The InChIKey is TVBXTYQIYYLSMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-2-6-14(16)18-12-11-17-10-9-15-13-7-4-3-5-8-13/h3-5,7-8,15H,2,6,9-12H2,1H3.
What are the key properties of 2-(2-anilinoethoxy)ethyl butanoate?
2-(2-anilinoethoxy)ethyl butanoate has a molecular weight of 251.33 g/mol, XLogP of 2.46, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-anilinoethoxy)ethyl butanoate is sourced from PubChem (CID 102065089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).