About 2-(2-anilinoethoxy)ethyl acetate
2-(2-anilinoethoxy)ethyl acetate (PubChem CID 102065081) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(2-anilinoethoxy)ethyl acetate.
Molecular Properties
| Compound Name | 2-(2-anilinoethoxy)ethyl acetate |
| PubChem CID | 102065081 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(2-anilinoethoxy)ethyl acetate |
| SMILES | CC(=O)OCCOCCNc1ccccc1 |
| InChI | InChI=1S/C12H17NO3/c1-11(14)16-10-9-15-8-7-13-12-5-3-2-4-6-12/h2-6,13H,7-10H2,1H3 |
| InChIKey | MOCHHACICXZXEN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-anilinoethoxy)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-anilinoethoxy)ethyl acetate?
The IUPAC name of 2-(2-anilinoethoxy)ethyl acetate (CID 102065081) is 2-(2-anilinoethoxy)ethyl acetate.
What is the SMILES notation for 2-(2-anilinoethoxy)ethyl acetate?
The canonical SMILES for 2-(2-anilinoethoxy)ethyl acetate is CC(=O)OCCOCCNc1ccccc1.
What is the InChIKey of 2-(2-anilinoethoxy)ethyl acetate?
The InChIKey is MOCHHACICXZXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-11(14)16-10-9-15-8-7-13-12-5-3-2-4-6-12/h2-6,13H,7-10H2,1H3.
What are the key properties of 2-(2-anilinoethoxy)ethyl acetate?
2-(2-anilinoethoxy)ethyl acetate has a molecular weight of 223.27 g/mol, XLogP of 1.68, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-anilinoethoxy)ethyl acetate is sourced from PubChem (CID 102065081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).