About 2-anilinoethyl 2-[acetyl(methyl)amino]acetate
2-anilinoethyl 2-[acetyl(methyl)amino]acetate (PubChem CID 70658920) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-anilinoethyl 2-[acetyl(methyl)amino]acetate.
Molecular Properties
| Compound Name | 2-anilinoethyl 2-[acetyl(methyl)amino]acetate |
| PubChem CID | 70658920 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-anilinoethyl 2-[acetyl(methyl)amino]acetate |
| SMILES | CC(=O)N(C)CC(=O)OCCNc1ccccc1 |
| InChI | InChI=1S/C13H18N2O3/c1-11(16)15(2)10-13(17)18-9-8-14-12-6-4-3-5-7-12/h3-7,14H,8-10H2,1-2H3 |
| InChIKey | LICKIEKNCHNQQM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-anilinoethyl 2-[acetyl(methyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinoethyl 2-[acetyl(methyl)amino]acetate?
The IUPAC name of 2-anilinoethyl 2-[acetyl(methyl)amino]acetate (CID 70658920) is 2-anilinoethyl 2-[acetyl(methyl)amino]acetate.
What is the SMILES notation for 2-anilinoethyl 2-[acetyl(methyl)amino]acetate?
The canonical SMILES for 2-anilinoethyl 2-[acetyl(methyl)amino]acetate is CC(=O)N(C)CC(=O)OCCNc1ccccc1.
What is the InChIKey of 2-anilinoethyl 2-[acetyl(methyl)amino]acetate?
The InChIKey is LICKIEKNCHNQQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3/c1-11(16)15(2)10-13(17)18-9-8-14-12-6-4-3-5-7-12/h3-7,14H,8-10H2,1-2H3.
What are the key properties of 2-anilinoethyl 2-[acetyl(methyl)amino]acetate?
2-anilinoethyl 2-[acetyl(methyl)amino]acetate has a molecular weight of 250.30 g/mol, XLogP of 1.12, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinoethyl 2-[acetyl(methyl)amino]acetate is sourced from PubChem (CID 70658920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).