C11H21NO3 — CID 78863396
3,3-dimethylbutyl 2-[acetyl(methyl)amino]acetate (PubChem CID 78863396) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 3,3-dimethylbutyl 2-[acetyl(methyl)amino]acetate.
| Compound Name | 3,3-dimethylbutyl 2-[acetyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 78863396 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 3,3-dimethylbutyl 2-[acetyl(methyl)amino]acetate |
| SMILES | CC(=O)N(C)CC(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-9(13)12(5)8-10(14)15-7-6-11(2,3)4/h6-8H2,1-5H3 |
| InChIKey | JGSXBIQLXZASHT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |