About bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride
bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride (PubChem CID 90411271) has the molecular formula C20H23ClN2O4
and a molecular weight of 390.87 g/mol. Its IUPAC name is bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride.
Molecular Properties
| Compound Name | bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride |
| PubChem CID | 90411271 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride |
| SMILES | Cl.O=C(/C=C/C(=O)OCCNc1ccccc1)OCCNc1ccccc1 |
| InChI | InChI=1S/C20H22N2O4.ClH/c23-19(25-15-13-21-17-7-3-1-4-8-17)11-12-20(24)26-16-14-22-18-9-5-2-6-10-18;/h1-12,21-22H,13-16H2;1H/b12-11+; |
| InChIKey | LAFUNXYKVYYDQP-CALJPSDSSA-N |
| XLogP | 3.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride?
The IUPAC name of bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride (CID 90411271) is bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride.
What is the SMILES notation for bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride?
The canonical SMILES for bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride is Cl.O=C(/C=C/C(=O)OCCNc1ccccc1)OCCNc1ccccc1.
What is the InChIKey of bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride?
The InChIKey is LAFUNXYKVYYDQP-CALJPSDSSA-N. The full InChI is InChI=1S/C20H22N2O4.ClH/c23-19(25-15-13-21-17-7-3-1-4-8-17)11-12-20(24)26-16-14-22-18-9-5-2-6-10-18;/h1-12,21-22H,13-16H2;1H/b12-11+;.
What are the key properties of bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride?
bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride has a molecular weight of 390.87 g/mol, XLogP of 3.28, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-anilinoethyl) (E)-but-2-enedioate;hydrochloride is sourced from PubChem (CID 90411271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).