C14H16N2O5 — CID 123909137
4-O-[2-(2-benzoylhydrazinyl)ethyl] 1-O-methyl but-2-enedioate (PubChem CID 123909137) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-O-[2-(2-benzoylhydrazinyl)ethyl] 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-[2-(2-benzoylhydrazinyl)ethyl] 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 123909137 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-O-[2-(2-benzoylhydrazinyl)ethyl] 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OCCNNC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16N2O5/c1-20-12(17)7-8-13(18)21-10-9-15-16-14(19)11-5-3-2-4-6-11/h2-8,15H,9-10H2,1H3,(H,16,19) |
| InChIKey | WZPNFAGEDAZSAB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|