C13H14N2O4 — CID 2507898
[2-(2-benzoylhydrazinyl)-2-oxoethyl] (E)-but-2-enoate (PubChem CID 2507898) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] (E)-but-2-enoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 2507898 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14N2O4/c1-2-6-12(17)19-9-11(16)14-15-13(18)10-7-4-3-5-8-10/h2-8H,9H2,1H3,(H,14,16)(H,15,18)/b6-2+ |
| InChIKey | ZQWWNIHBFAHDPE-QHHAFSJGSA-N |
| XLogP | 0.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|