C15H15N3O6 — CID 16958723
[2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 16958723) has the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. Its IUPAC name is [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 16958723 |
| Molecular Formula | C15H15N3O6 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCC(=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15N3O6/c1-2-3-4-8-14(20)24-10-13(19)16-17-15(21)11-6-5-7-12(9-11)18(22)23/h2-9H,10H2,1H3,(H,16,19)(H,17,21)/b3-2+,8-4+ |
| InChIKey | XUMFZQYLKZXARH-CRBCFSCISA-N |
| XLogP | 1.03 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|