C22H25N3O7 — CID 16796691
[2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate (PubChem CID 16796691) has the molecular formula C22H25N3O7 and a molecular weight of 443.46 g/mol. Its IUPAC name is [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate.
| Compound Name | [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate |
|---|---|
| PubChem CID | 16796691 |
| Molecular Formula | C22H25N3O7 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate |
| SMILES | CC(C)(C)c1ccc(OCCC(=O)OCC(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H25N3O7/c1-22(2,3)16-7-9-18(10-8-16)31-12-11-20(27)32-14-19(26)23-24-21(28)15-5-4-6-17(13-15)25(29)30/h4-10,13H,11-12,14H2,1-3H3,(H,23,26)(H,24,28) |
| InChIKey | MKAYLWFGKDYIPO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|