C18H14F3N3O6 — CID 16525026
[2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 16525026) has the molecular formula C18H14F3N3O6 and a molecular weight of 425.32 g/mol. Its IUPAC name is [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 16525026 |
| Molecular Formula | C18H14F3N3O6 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | O=C(COC(=O)Cc1cccc(C(F)(F)F)c1)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14F3N3O6/c19-18(20,21)13-5-1-3-11(7-13)8-16(26)30-10-15(25)22-23-17(27)12-4-2-6-14(9-12)24(28)29/h1-7,9H,8,10H2,(H,22,25)(H,23,27) |
| InChIKey | XKQCFJWWKCQADO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|