C24H32N2O8S — CID 145160262
4-O-(2-anilinoethyl) 1-O-methyl (E)-but-2-enedioate;1-O-methyl 4-O-(2-thiomorpholin-4-ylethyl) (E)-but-2-enedioate (PubChem CID 145160262) has the molecular formula C24H32N2O8S and a molecular weight of 508.59 g/mol. Its IUPAC name is 4-O-(2-anilinoethyl) 1-O-methyl (E)-but-2-enedioate;1-O-methyl 4-O-(2-thiomorpholin-4-ylethyl) (E)-but-2-enedioate.
| Compound Name | 4-O-(2-anilinoethyl) 1-O-methyl (E)-but-2-enedioate;1-O-methyl 4-O-(2-thiomorpholin-4-ylethyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 145160262 |
| Molecular Formula | C24H32N2O8S |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 4-O-(2-anilinoethyl) 1-O-methyl (E)-but-2-enedioate;1-O-methyl 4-O-(2-thiomorpholin-4-ylethyl) (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCCN1CCSCC1.COC(=O)/C=C/C(=O)OCCNc1ccccc1 |
| InChI | InChI=1S/C13H15NO4.C11H17NO4S/c1-17-12(15)7-8-13(16)18-10-9-14-11-5-3-2-4-6-11;1-15-10(13)2-3-11(14)16-7-4-12-5-8-17-9-6-12/h2-8,14H,9-10H2,1H3;2-3H,4-9H2,1H3/b8-7+;3-2+ |
| InChIKey | NLHKDKNUXNDAJP-WEJJKVBXSA-N |
| XLogP | 1.68 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|