C12H17F2NO4 — CID 149193652
4-O-[2-(3,4-difluoropiperidin-1-yl)ethyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 149193652) has the molecular formula C12H17F2NO4 and a molecular weight of 277.27 g/mol. Its IUPAC name is 4-O-[2-(3,4-difluoropiperidin-1-yl)ethyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-(3,4-difluoropiperidin-1-yl)ethyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 149193652 |
| Molecular Formula | C12H17F2NO4 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-O-[2-(3,4-difluoropiperidin-1-yl)ethyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCCN1CCC(F)C(F)C1 |
| InChI | InChI=1S/C12H17F2NO4/c1-18-11(16)2-3-12(17)19-7-6-15-5-4-9(13)10(14)8-15/h2-3,9-10H,4-8H2,1H3/b3-2+ |
| InChIKey | XDIBOSJHQBSDCX-NSCUHMNNSA-N |
| XLogP | 0.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|