C8H17FN2O — CID 124748320
(3S,4R)-3-fluoro-1-(2-methoxyethyl)piperidin-4-amine (PubChem CID 124748320) has the molecular formula C8H17FN2O and a molecular weight of 176.23 g/mol. Its IUPAC name is (3S,4R)-3-fluoro-1-(2-methoxyethyl)piperidin-4-amine.
| Compound Name | (3S,4R)-3-fluoro-1-(2-methoxyethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 124748320 |
| Molecular Formula | C8H17FN2O |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (3S,4R)-3-fluoro-1-(2-methoxyethyl)piperidin-4-amine |
| SMILES | COCCN1CC[C@@H](N)[C@@H](F)C1 |
| InChI | InChI=1S/C8H17FN2O/c1-12-5-4-11-3-2-8(10)7(9)6-11/h7-8H,2-6,10H2,1H3/t7-,8+/m0/s1 |
| InChIKey | WRGAGXKXGAGBPZ-JGVFFNPUSA-N |
| XLogP | 0.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |