C15H30N2O2 — CID 177178896
(4aR,8aR)-2-(2-ethoxyethyl)-6-(2-methoxyethyl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine (PubChem CID 177178896) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (4aR,8aR)-2-(2-ethoxyethyl)-6-(2-methoxyethyl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine.
| Compound Name | (4aR,8aR)-2-(2-ethoxyethyl)-6-(2-methoxyethyl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine |
|---|---|
| PubChem CID | 177178896 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (4aR,8aR)-2-(2-ethoxyethyl)-6-(2-methoxyethyl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine |
| SMILES | CCOCCN1CC[C@H]2CN(CCOC)CC[C@H]2C1 |
| InChI | InChI=1S/C15H30N2O2/c1-3-19-11-9-17-7-5-14-12-16(8-10-18-2)6-4-15(14)13-17/h14-15H,3-13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | FNIKRKBCKWSWCK-GJZGRUSLSA-N |
| XLogP | 1.31 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|