C17H36N2O2 — CID 177178993
ethane;2-(2-ethoxyethyl)-6-(2-methoxyethyl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine (PubChem CID 177178993) has the molecular formula C17H36N2O2 and a molecular weight of 300.49 g/mol. Its IUPAC name is ethane;2-(2-ethoxyethyl)-6-(2-methoxyethyl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine.
| Compound Name | ethane;2-(2-ethoxyethyl)-6-(2-methoxyethyl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine |
|---|---|
| PubChem CID | 177178993 |
| Molecular Formula | C17H36N2O2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | ethane;2-(2-ethoxyethyl)-6-(2-methoxyethyl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine |
| SMILES | CC.CCOCCN1CCC2CN(CCOC)CCC2C1 |
| InChI | InChI=1S/C15H30N2O2.C2H6/c1-3-19-11-9-17-7-5-14-12-16(8-10-18-2)6-4-15(14)13-17;1-2/h14-15H,3-13H2,1-2H3;1-2H3 |
| InChIKey | KZQRSTQVZPOLMG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|