C10H20N2O — CID 81490697
3-(2-methoxyethyl)-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 81490697) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-(2-methoxyethyl)-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 81490697 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-(2-methoxyethyl)-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | COCCN1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C10H20N2O/c1-13-7-6-12-5-4-9-2-3-10(8-12)11-9/h9-11H,2-8H2,1H3 |
| InChIKey | NVBJAFLQNWAVOX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |