About 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite
3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite (PubChem CID 170772093) has the molecular formula C9H20FNO3
and a molecular weight of 209.26 g/mol. Its IUPAC name is 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite.
Molecular Properties
| Compound Name | 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite |
| PubChem CID | 170772093 |
| Molecular Formula | C9H20FNO3 |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite |
| SMILES | COCCN1CCC(OC)C1.COF |
| InChI | InChI=1S/C8H17NO2.CH3FO/c1-10-6-5-9-4-3-8(7-9)11-2;1-3-2/h8H,3-7H2,1-2H3;1H3 |
| InChIKey | JWMXBNZFQZICGR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite?
The IUPAC name of 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite (CID 170772093) is 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite.
What is the SMILES notation for 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite?
The canonical SMILES for 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite is COCCN1CCC(OC)C1.COF.
What is the InChIKey of 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite?
The InChIKey is JWMXBNZFQZICGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.CH3FO/c1-10-6-5-9-4-3-8(7-9)11-2;1-3-2/h8H,3-7H2,1-2H3;1H3.
What are the key properties of 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite?
3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite has a molecular weight of 209.26 g/mol, XLogP of 0.87, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1-(2-methoxyethyl)pyrrolidine;methyl hypofluorite is sourced from PubChem (CID 170772093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).