C10H20N2OS — CID 131015156
3-(2-methylsulfinylethyl)-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 131015156) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is 3-(2-methylsulfinylethyl)-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-(2-methylsulfinylethyl)-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 131015156 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3-(2-methylsulfinylethyl)-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | CS(=O)CCN1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C10H20N2OS/c1-14(13)7-6-12-5-4-9-2-3-10(8-12)11-9/h9-11H,2-8H2,1H3 |
| InChIKey | QMIOVVBEEUJIGH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |