C16H27NO5 — CID 123594724
4-O-[2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl] 1-O-methyl but-2-enedioate (PubChem CID 123594724) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 4-O-[2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl] 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-[2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl] 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 123594724 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 4-O-[2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl] 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OCCN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C16H27NO5/c1-15(2)10-12(18)11-16(3,4)17(15)8-9-22-14(20)7-6-13(19)21-5/h6-7,12,18H,8-11H2,1-5H3 |
| InChIKey | YFAURVBUEGYYBT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|