C15H25NO4 — CID 129289120
2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-oxocyclopropane-1-carboxylate (PubChem CID 129289120) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-oxocyclopropane-1-carboxylate.
| Compound Name | 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-oxocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 129289120 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 2-oxocyclopropane-1-carboxylate |
| SMILES | CC1(C)CC(O)CC(C)(C)N1CCOC(=O)C1CC1=O |
| InChI | InChI=1S/C15H25NO4/c1-14(2)8-10(17)9-15(3,4)16(14)5-6-20-13(19)11-7-12(11)18/h10-11,17H,5-9H2,1-4H3 |
| InChIKey | OYWDWBURYWKAGW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|