About 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride
4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride (PubChem CID 90411125) has the molecular formula C14H25ClN2O5
and a molecular weight of 336.82 g/mol. Its IUPAC name is 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride.
Molecular Properties
| Compound Name | 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride |
| PubChem CID | 90411125 |
| Molecular Formula | C14H25ClN2O5 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride |
| SMILES | COC(=O)/C=C/C(=O)OCCN1CCOC(CN(C)C)C1.Cl |
| InChI | InChI=1S/C14H24N2O5.ClH/c1-15(2)10-12-11-16(6-8-20-12)7-9-21-14(18)5-4-13(17)19-3;/h4-5,12H,6-11H2,1-3H3;1H/b5-4+; |
| InChIKey | UVPGJJCZNUTEDA-FXRZFVDSSA-N |
| XLogP | -0.06 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride?
The IUPAC name of 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride (CID 90411125) is 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride.
What is the SMILES notation for 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride?
The canonical SMILES for 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride is COC(=O)/C=C/C(=O)OCCN1CCOC(CN(C)C)C1.Cl.
What is the InChIKey of 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride?
The InChIKey is UVPGJJCZNUTEDA-FXRZFVDSSA-N. The full InChI is InChI=1S/C14H24N2O5.ClH/c1-15(2)10-12-11-16(6-8-20-12)7-9-21-14(18)5-4-13(17)19-3;/h4-5,12H,6-11H2,1-3H3;1H/b5-4+;.
What are the key properties of 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride?
4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride has a molecular weight of 336.82 g/mol, XLogP of -0.06, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[2-[2-[(dimethylamino)methyl]morpholin-4-yl]ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride is sourced from PubChem (CID 90411125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).