C15H17NO6 — CID 123419793
4-O-[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethyl] 1-O-methyl but-2-enedioate (PubChem CID 123419793) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is 4-O-[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethyl] 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethyl] 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 123419793 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-O-[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethyl] 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OCCn1c(O)c2c(c1O)CC=CC2 |
| InChI | InChI=1S/C15H17NO6/c1-21-12(17)6-7-13(18)22-9-8-16-14(19)10-4-2-3-5-11(10)15(16)20/h2-3,6-7,19-20H,4-5,8-9H2,1H3 |
| InChIKey | MADKXGQMBAXHHT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|