About 2-anilinoethyl 2-methylsulfanylacetate
2-anilinoethyl 2-methylsulfanylacetate (PubChem CID 70658906) has the molecular formula C11H15NO2S
and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-anilinoethyl 2-methylsulfanylacetate.
Molecular Properties
| Compound Name | 2-anilinoethyl 2-methylsulfanylacetate |
| PubChem CID | 70658906 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-anilinoethyl 2-methylsulfanylacetate |
| SMILES | CSCC(=O)OCCNc1ccccc1 |
| InChI | InChI=1S/C11H15NO2S/c1-15-9-11(13)14-8-7-12-10-5-3-2-4-6-10/h2-6,12H,7-9H2,1H3 |
| InChIKey | GSDJBUVUSVSIEQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-anilinoethyl 2-methylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinoethyl 2-methylsulfanylacetate?
The IUPAC name of 2-anilinoethyl 2-methylsulfanylacetate (CID 70658906) is 2-anilinoethyl 2-methylsulfanylacetate.
What is the SMILES notation for 2-anilinoethyl 2-methylsulfanylacetate?
The canonical SMILES for 2-anilinoethyl 2-methylsulfanylacetate is CSCC(=O)OCCNc1ccccc1.
What is the InChIKey of 2-anilinoethyl 2-methylsulfanylacetate?
The InChIKey is GSDJBUVUSVSIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c1-15-9-11(13)14-8-7-12-10-5-3-2-4-6-10/h2-6,12H,7-9H2,1H3.
What are the key properties of 2-anilinoethyl 2-methylsulfanylacetate?
2-anilinoethyl 2-methylsulfanylacetate has a molecular weight of 225.31 g/mol, XLogP of 2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinoethyl 2-methylsulfanylacetate is sourced from PubChem (CID 70658906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).