About 4-anilinobutanamide
4-anilinobutanamide (PubChem CID 67066705) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 4-anilinobutanamide.
Molecular Properties
| Compound Name | 4-anilinobutanamide |
| PubChem CID | 67066705 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-anilinobutanamide |
| SMILES | NC(=O)CCCNc1ccccc1 |
| InChI | InChI=1S/C10H14N2O/c11-10(13)7-4-8-12-9-5-2-1-3-6-9/h1-3,5-6,12H,4,7-8H2,(H2,11,13) |
| InChIKey | PRFLECRLXWVWDM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-anilinobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilinobutanamide?
The IUPAC name of 4-anilinobutanamide (CID 67066705) is 4-anilinobutanamide.
What is the SMILES notation for 4-anilinobutanamide?
The canonical SMILES for 4-anilinobutanamide is NC(=O)CCCNc1ccccc1.
What is the InChIKey of 4-anilinobutanamide?
The InChIKey is PRFLECRLXWVWDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c11-10(13)7-4-8-12-9-5-2-1-3-6-9/h1-3,5-6,12H,4,7-8H2,(H2,11,13).
What are the key properties of 4-anilinobutanamide?
4-anilinobutanamide has a molecular weight of 178.24 g/mol, XLogP of 1.36, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilinobutanamide is sourced from PubChem (CID 67066705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).