About 3-anilinopropan-1-ol;phosphoric acid
3-anilinopropan-1-ol;phosphoric acid (PubChem CID 66984453) has the molecular formula C9H16NO5P
and a molecular weight of 249.20 g/mol. Its IUPAC name is 3-anilinopropan-1-ol;phosphoric acid.
Molecular Properties
| Compound Name | 3-anilinopropan-1-ol;phosphoric acid |
| PubChem CID | 66984453 |
| Molecular Formula | C9H16NO5P |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 3-anilinopropan-1-ol;phosphoric acid |
| SMILES | O=P(O)(O)O.OCCCNc1ccccc1 |
| InChI | InChI=1S/C9H13NO.H3O4P/c11-8-4-7-10-9-5-2-1-3-6-9;1-5(2,3)4/h1-3,5-6,10-11H,4,7-8H2;(H3,1,2,3,4) |
| InChIKey | RQKFCGINMGDVIX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-anilinopropan-1-ol;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilinopropan-1-ol;phosphoric acid?
The IUPAC name of 3-anilinopropan-1-ol;phosphoric acid (CID 66984453) is 3-anilinopropan-1-ol;phosphoric acid.
What is the SMILES notation for 3-anilinopropan-1-ol;phosphoric acid?
The canonical SMILES for 3-anilinopropan-1-ol;phosphoric acid is O=P(O)(O)O.OCCCNc1ccccc1.
What is the InChIKey of 3-anilinopropan-1-ol;phosphoric acid?
The InChIKey is RQKFCGINMGDVIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.H3O4P/c11-8-4-7-10-9-5-2-1-3-6-9;1-5(2,3)4/h1-3,5-6,10-11H,4,7-8H2;(H3,1,2,3,4).
What are the key properties of 3-anilinopropan-1-ol;phosphoric acid?
3-anilinopropan-1-ol;phosphoric acid has a molecular weight of 249.20 g/mol, XLogP of 0.55, 4 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilinopropan-1-ol;phosphoric acid is sourced from PubChem (CID 66984453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).