C15H20N2O2 — CID 160711297
N,N'-diphenylmethanediamine;ethane-1,2-diol (PubChem CID 160711297) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N,N'-diphenylmethanediamine;ethane-1,2-diol.
| Compound Name | N,N'-diphenylmethanediamine;ethane-1,2-diol |
|---|---|
| PubChem CID | 160711297 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N,N'-diphenylmethanediamine;ethane-1,2-diol |
| SMILES | OCCO.c1ccc(NCNc2ccccc2)cc1 |
| InChI | InChI=1S/C13H14N2.C2H6O2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;3-1-2-4/h1-10,14-15H,11H2;3-4H,1-2H2 |
| InChIKey | RRWWXXWPODJQKL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|