About N-benzyl-N'-phenylmethanediamine
N-benzyl-N'-phenylmethanediamine (PubChem CID 151589453) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is N-benzyl-N'-phenylmethanediamine.
Molecular Properties
| Compound Name | N-benzyl-N'-phenylmethanediamine |
| PubChem CID | 151589453 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-benzyl-N'-phenylmethanediamine |
| SMILES | c1ccc(CNCNc2ccccc2)cc1 |
| InChI | InChI=1S/C14H16N2/c1-3-7-13(8-4-1)11-15-12-16-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | DIIPUOAUJMFOOW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-phenylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-phenylmethanediamine?
The IUPAC name of N-benzyl-N'-phenylmethanediamine (CID 151589453) is N-benzyl-N'-phenylmethanediamine.
What is the SMILES notation for N-benzyl-N'-phenylmethanediamine?
The canonical SMILES for N-benzyl-N'-phenylmethanediamine is c1ccc(CNCNc2ccccc2)cc1.
What is the InChIKey of N-benzyl-N'-phenylmethanediamine?
The InChIKey is DIIPUOAUJMFOOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-3-7-13(8-4-1)11-15-12-16-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2.
What are the key properties of N-benzyl-N'-phenylmethanediamine?
N-benzyl-N'-phenylmethanediamine has a molecular weight of 212.30 g/mol, XLogP of 2.85, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-phenylmethanediamine is sourced from PubChem (CID 151589453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).