About N-benzyl-1-phenylmethanamine;dichlorotitanium
N-benzyl-1-phenylmethanamine;dichlorotitanium (PubChem CID 174633271) has the molecular formula C14H15Cl2NTi
and a molecular weight of 316.05 g/mol. Its IUPAC name is N-benzyl-1-phenylmethanamine;dichlorotitanium.
Molecular Properties
| Compound Name | N-benzyl-1-phenylmethanamine;dichlorotitanium |
| PubChem CID | 174633271 |
| Molecular Formula | C14H15Cl2NTi |
| Molecular Weight | 316.05 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | N-benzyl-1-phenylmethanamine;dichlorotitanium |
| SMILES | Cl[Ti]Cl.c1ccc(CNCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N.2ClH.Ti/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;;/h1-10,15H,11-12H2;2*1H;/q;;;+2/p-2 |
| InChIKey | DLNLMNWWWQBWBN-UHFFFAOYSA-L |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.05 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-1-phenylmethanamine;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-phenylmethanamine;dichlorotitanium?
The IUPAC name of N-benzyl-1-phenylmethanamine;dichlorotitanium (CID 174633271) is N-benzyl-1-phenylmethanamine;dichlorotitanium.
What is the SMILES notation for N-benzyl-1-phenylmethanamine;dichlorotitanium?
The canonical SMILES for N-benzyl-1-phenylmethanamine;dichlorotitanium is Cl[Ti]Cl.c1ccc(CNCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-1-phenylmethanamine;dichlorotitanium?
The InChIKey is DLNLMNWWWQBWBN-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H15N.2ClH.Ti/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;;/h1-10,15H,11-12H2;2*1H;/q;;;+2/p-2.
What are the key properties of N-benzyl-1-phenylmethanamine;dichlorotitanium?
N-benzyl-1-phenylmethanamine;dichlorotitanium has a molecular weight of 316.05 g/mol, XLogP of 4.35, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-phenylmethanamine;dichlorotitanium is sourced from PubChem (CID 174633271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).