C18H20N2O3 — CID 110890234
4-[(2-hydroxy-2,2-diphenylacetyl)amino]butanamide (PubChem CID 110890234) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[(2-hydroxy-2,2-diphenylacetyl)amino]butanamide.
| Compound Name | 4-[(2-hydroxy-2,2-diphenylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 110890234 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-[(2-hydroxy-2,2-diphenylacetyl)amino]butanamide |
| SMILES | NC(=O)CCCNC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c19-16(21)12-7-13-20-17(22)18(23,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,23H,7,12-13H2,(H2,19,21)(H,20,22) |
| InChIKey | ZFVFGJPIYHIHSJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|