C16H25N3O2 — CID 120591033
N-[2-[(2-amino-2-phenylpropanoyl)amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 120591033) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is N-[2-[(2-amino-2-phenylpropanoyl)amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[(2-amino-2-phenylpropanoyl)amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 120591033 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-[2-[(2-amino-2-phenylpropanoyl)amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCNC(=O)C(C)(N)c1ccccc1 |
| InChI | InChI=1S/C16H25N3O2/c1-15(2,3)13(20)18-10-11-19-14(21)16(4,17)12-8-6-5-7-9-12/h5-9H,10-11,17H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | SWCVRGUGQWYIJN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|