C13H21ClN2O3S — CID 120591623
2-amino-N-(2-ethylsulfonylethyl)-2-phenylpropanamide;hydrochloride (PubChem CID 120591623) has the molecular formula C13H21ClN2O3S and a molecular weight of 320.84 g/mol. Its IUPAC name is 2-amino-N-(2-ethylsulfonylethyl)-2-phenylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-(2-ethylsulfonylethyl)-2-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120591623 |
| Molecular Formula | C13H21ClN2O3S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-amino-N-(2-ethylsulfonylethyl)-2-phenylpropanamide;hydrochloride |
| SMILES | CCS(=O)(=O)CCNC(=O)C(C)(N)c1ccccc1.Cl |
| InChI | InChI=1S/C13H20N2O3S.ClH/c1-3-19(17,18)10-9-15-12(16)13(2,14)11-7-5-4-6-8-11;/h4-8H,3,9-10,14H2,1-2H3,(H,15,16);1H |
| InChIKey | HHNWXIFQDVTCSI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |