C12H16ClF3N2OS — CID 120588992
2-amino-2-phenyl-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide;hydrochloride (PubChem CID 120588992) has the molecular formula C12H16ClF3N2OS and a molecular weight of 328.79 g/mol. Its IUPAC name is 2-amino-2-phenyl-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide;hydrochloride.
| Compound Name | 2-amino-2-phenyl-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120588992 |
| Molecular Formula | C12H16ClF3N2OS |
| Molecular Weight | 328.79 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-amino-2-phenyl-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide;hydrochloride |
| SMILES | CC(N)(C(=O)NCCSC(F)(F)F)c1ccccc1.Cl |
| InChI | InChI=1S/C12H15F3N2OS.ClH/c1-11(16,9-5-3-2-4-6-9)10(18)17-7-8-19-12(13,14)15;/h2-6H,7-8,16H2,1H3,(H,17,18);1H |
| InChIKey | PNWBUASOEWJFIV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.79 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|