C17H26ClN3O2 — CID 120593685
N-[3-[(2-amino-2-phenylpropanoyl)amino]propyl]cyclobutanecarboxamide;hydrochloride (PubChem CID 120593685) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is N-[3-[(2-amino-2-phenylpropanoyl)amino]propyl]cyclobutanecarboxamide;hydrochloride.
| Compound Name | N-[3-[(2-amino-2-phenylpropanoyl)amino]propyl]cyclobutanecarboxamide;hydrochloride |
|---|---|
| PubChem CID | 120593685 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[3-[(2-amino-2-phenylpropanoyl)amino]propyl]cyclobutanecarboxamide;hydrochloride |
| SMILES | CC(N)(C(=O)NCCCNC(=O)C1CCC1)c1ccccc1.Cl |
| InChI | InChI=1S/C17H25N3O2.ClH/c1-17(18,14-9-3-2-4-10-14)16(22)20-12-6-11-19-15(21)13-7-5-8-13;/h2-4,9-10,13H,5-8,11-12,18H2,1H3,(H,19,21)(H,20,22);1H |
| InChIKey | DGFVGAMASHJFNG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|