C20H21N3O2 — CID 110887930
2-hydroxy-2,2-diphenyl-N-(3-pyrazol-1-ylpropyl)acetamide (PubChem CID 110887930) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-hydroxy-2,2-diphenyl-N-(3-pyrazol-1-ylpropyl)acetamide.
| Compound Name | 2-hydroxy-2,2-diphenyl-N-(3-pyrazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 110887930 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-hydroxy-2,2-diphenyl-N-(3-pyrazol-1-ylpropyl)acetamide |
| SMILES | O=C(NCCCn1cccn1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O2/c24-19(21-13-7-15-23-16-8-14-22-23)20(25,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,8-12,14,16,25H,7,13,15H2,(H,21,24) |
| InChIKey | SCMQYTITLDTEMQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|