C17H17N3O2 — CID 37392558
3-phenyl-N-(3-pyrazol-1-ylpropyl)furan-2-carboxamide (PubChem CID 37392558) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-phenyl-N-(3-pyrazol-1-ylpropyl)furan-2-carboxamide.
| Compound Name | 3-phenyl-N-(3-pyrazol-1-ylpropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 37392558 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 3-phenyl-N-(3-pyrazol-1-ylpropyl)furan-2-carboxamide |
| SMILES | O=C(NCCCn1cccn1)c1occc1-c1ccccc1 |
| InChI | InChI=1S/C17H17N3O2/c21-17(18-9-4-11-20-12-5-10-19-20)16-15(8-13-22-16)14-6-2-1-3-7-14/h1-3,5-8,10,12-13H,4,9,11H2,(H,18,21) |
| InChIKey | ONBUVWGVGSHOCJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|