C22H19N3O2 — CID 43045643
3-phenyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]furan-2-carboxamide (PubChem CID 43045643) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-phenyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]furan-2-carboxamide.
| Compound Name | 3-phenyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43045643 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-phenyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCc1ccc(-n2cccn2)cc1)c1occc1-c1ccccc1 |
| InChI | InChI=1S/C22H19N3O2/c26-22(21-20(12-16-27-21)18-5-2-1-3-6-18)23-14-11-17-7-9-19(10-8-17)25-15-4-13-24-25/h1-10,12-13,15-16H,11,14H2,(H,23,26) |
| InChIKey | WVUKMSDSIMUTQV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |