C19H22ClN3O5 — CID 139920455
[(2-hydroxy-2,2-diphenylacetyl)amino]methyl (3S)-3,4-diamino-4-oxobutanoate;hydrochloride (PubChem CID 139920455) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is [(2-hydroxy-2,2-diphenylacetyl)amino]methyl (3S)-3,4-diamino-4-oxobutanoate;hydrochloride.
| Compound Name | [(2-hydroxy-2,2-diphenylacetyl)amino]methyl (3S)-3,4-diamino-4-oxobutanoate;hydrochloride |
|---|---|
| PubChem CID | 139920455 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [(2-hydroxy-2,2-diphenylacetyl)amino]methyl (3S)-3,4-diamino-4-oxobutanoate;hydrochloride |
| SMILES | Cl.NC(=O)[C@@H](N)CC(=O)OCNC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O5.ClH/c20-15(17(21)24)11-16(23)27-12-22-18(25)19(26,13-7-3-1-4-8-13)14-9-5-2-6-10-14;/h1-10,15,26H,11-12,20H2,(H2,21,24)(H,22,25);1H/t15-;/m0./s1 |
| InChIKey | FBZRHRVMWLGZRR-RSAXXLAASA-N |
| XLogP | 0.16 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|