C21H26N2O4 — CID 139687062
[2-[(1S)-2-(ethylamino)-1-hydroxy-2-oxo-1-phenylethyl]phenyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 139687062) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-[(1S)-2-(ethylamino)-1-hydroxy-2-oxo-1-phenylethyl]phenyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [2-[(1S)-2-(ethylamino)-1-hydroxy-2-oxo-1-phenylethyl]phenyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 139687062 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [2-[(1S)-2-(ethylamino)-1-hydroxy-2-oxo-1-phenylethyl]phenyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CCNC(=O)[C@](O)(c1ccccc1)c1ccccc1OC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C21H26N2O4/c1-4-23-20(25)21(26,15-10-6-5-7-11-15)16-12-8-9-13-17(16)27-19(24)18(22)14(2)3/h5-14,18,26H,4,22H2,1-3H3,(H,23,25)/t18-,21-/m0/s1 |
| InChIKey | KAAAGIVJFBNOOH-RXVVDRJESA-N |
| XLogP | 1.95 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|