C15H26N2O2 — CID 143150724
4-amino-N-ethyl-2,3-dimethyl-2-phenylbutanamide;methanol (PubChem CID 143150724) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-amino-N-ethyl-2,3-dimethyl-2-phenylbutanamide;methanol.
| Compound Name | 4-amino-N-ethyl-2,3-dimethyl-2-phenylbutanamide;methanol |
|---|---|
| PubChem CID | 143150724 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 4-amino-N-ethyl-2,3-dimethyl-2-phenylbutanamide;methanol |
| SMILES | CCNC(=O)C(C)(c1ccccc1)C(C)CN.CO |
| InChI | InChI=1S/C14H22N2O.CH4O/c1-4-16-13(17)14(3,11(2)10-15)12-8-6-5-7-9-12;1-2/h5-9,11H,4,10,15H2,1-3H3,(H,16,17);2H,1H3 |
| InChIKey | YOKYKQHFGLCNNW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |