C14H17F3N2O3 — CID 69130043
[2-(trifluoromethyl)phenyl] 2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetate (PubChem CID 69130043) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl] 2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetate.
| Compound Name | [2-(trifluoromethyl)phenyl] 2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetate |
|---|---|
| PubChem CID | 69130043 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [2-(trifluoromethyl)phenyl] 2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetate |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O3/c1-8(2)12(18)13(21)19-7-11(20)22-10-6-4-3-5-9(10)14(15,16)17/h3-6,8,12H,7,18H2,1-2H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | HAANLAOIVDLOSO-LBPRGKRZSA-N |
| XLogP | 1.71 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|