C10H11F3NO5P — CID 54454024
[[2-oxo-2-[2-(trifluoromethyl)phenoxy]ethyl]amino]methylphosphonic acid (PubChem CID 54454024) has the molecular formula C10H11F3NO5P and a molecular weight of 313.17 g/mol. Its IUPAC name is [[2-oxo-2-[2-(trifluoromethyl)phenoxy]ethyl]amino]methylphosphonic acid.
| Compound Name | [[2-oxo-2-[2-(trifluoromethyl)phenoxy]ethyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 54454024 |
| Molecular Formula | C10H11F3NO5P |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | [[2-oxo-2-[2-(trifluoromethyl)phenoxy]ethyl]amino]methylphosphonic acid |
| SMILES | O=C(CNCP(=O)(O)O)Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3NO5P/c11-10(12,13)7-3-1-2-4-8(7)19-9(15)5-14-6-20(16,17)18/h1-4,14H,5-6H2,(H2,16,17,18) |
| InChIKey | WWXLGKBVGWBWKW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|