C11H14ClF3N2O2 — CID 69274933
2-[2-[2-(trifluoromethyl)phenoxy]ethylamino]acetamide;hydrochloride (PubChem CID 69274933) has the molecular formula C11H14ClF3N2O2 and a molecular weight of 298.69 g/mol. Its IUPAC name is 2-[2-[2-(trifluoromethyl)phenoxy]ethylamino]acetamide;hydrochloride.
| Compound Name | 2-[2-[2-(trifluoromethyl)phenoxy]ethylamino]acetamide;hydrochloride |
|---|---|
| PubChem CID | 69274933 |
| Molecular Formula | C11H14ClF3N2O2 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[2-[2-(trifluoromethyl)phenoxy]ethylamino]acetamide;hydrochloride |
| SMILES | Cl.NC(=O)CNCCOc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O2.ClH/c12-11(13,14)8-3-1-2-4-9(8)18-6-5-16-7-10(15)17;/h1-4,16H,5-7H2,(H2,15,17);1H |
| InChIKey | HCKOTLCPIXPNCY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|