C9H5F5O3 — CID 43651852
2,2-difluoro-2-[2-(trifluoromethyl)phenoxy]acetic acid (PubChem CID 43651852) has the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. Its IUPAC name is 2,2-difluoro-2-[2-(trifluoromethyl)phenoxy]acetic acid.
| Compound Name | 2,2-difluoro-2-[2-(trifluoromethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 43651852 |
| Molecular Formula | C9H5F5O3 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2,2-difluoro-2-[2-(trifluoromethyl)phenoxy]acetic acid |
| SMILES | O=C(O)C(F)(F)Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C9H5F5O3/c10-8(11,12)5-3-1-2-4-6(5)17-9(13,14)7(15)16/h1-4H,(H,15,16) |
| InChIKey | MBSGVNXHUFEUGE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |