C22H24N2O5S2 — CID 170847509
(2R)-2-amino-3-tritylsulfanylpropanamide;sulfuric acid (PubChem CID 170847509) has the molecular formula C22H24N2O5S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (2R)-2-amino-3-tritylsulfanylpropanamide;sulfuric acid.
| Compound Name | (2R)-2-amino-3-tritylsulfanylpropanamide;sulfuric acid |
|---|---|
| PubChem CID | 170847509 |
| Molecular Formula | C22H24N2O5S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (2R)-2-amino-3-tritylsulfanylpropanamide;sulfuric acid |
| SMILES | NC(=O)[C@@H](N)CSC(c1ccccc1)(c1ccccc1)c1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/C22H22N2OS.H2O4S/c23-20(21(24)25)16-26-22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-5(2,3)4/h1-15,20H,16,23H2,(H2,24,25);(H2,1,2,3,4)/t20-;/m0./s1 |
| InChIKey | ZIFCSCZINGHYLW-BDQAORGHSA-N |
| XLogP | 2.87 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|