C25H26N2O3S — CID 24860491
2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]propanoic acid (PubChem CID 24860491) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]propanoic acid.
| Compound Name | 2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 24860491 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)[C@@H](N)CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H26N2O3S/c1-18(24(29)30)27-23(28)22(26)17-31-25(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,18,22H,17,26H2,1H3,(H,27,28)(H,29,30)/t18?,22-/m0/s1 |
| InChIKey | FZQYVSVNAAICAM-YSYXNDDBSA-N |
| XLogP | 3.63 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|