C24H24N2O3S — CID 21117270
2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]acetic acid (PubChem CID 21117270) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 21117270 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]acetic acid |
| SMILES | N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C24H24N2O3S/c25-21(23(29)26-16-22(27)28)17-30-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21H,16-17,25H2,(H,26,29)(H,27,28)/t21-/m0/s1 |
| InChIKey | CQWAYRTZXZSUEP-NRFANRHFSA-N |
| XLogP | 3.24 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|