C18H20N2O3S — CID 91976170
2-[[(2R)-2-amino-3-benzhydrylsulfanylpropanoyl]amino]acetic acid (PubChem CID 91976170) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3-benzhydrylsulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-amino-3-benzhydrylsulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 91976170 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[[(2R)-2-amino-3-benzhydrylsulfanylpropanoyl]amino]acetic acid |
| SMILES | N[C@@H](CSC(c1ccccc1)c1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C18H20N2O3S/c19-15(18(23)20-11-16(21)22)12-24-17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15,17H,11-12,19H2,(H,20,23)(H,21,22)/t15-/m0/s1 |
| InChIKey | VCCOYCCXZHRTFQ-HNNXBMFYSA-N |
| XLogP | 2.04 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |