C21H23N3O5S — CID 10693882
2-[[2-[[2-[(2-benzhydrylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetic acid (PubChem CID 10693882) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-benzhydrylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[(2-benzhydrylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 10693882 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-[[2-[[2-[(2-benzhydrylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)CNC(=O)CSC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O5S/c25-17(22-11-18(26)24-13-20(28)29)12-23-19(27)14-30-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,21H,11-14H2,(H,22,25)(H,23,27)(H,24,26)(H,28,29) |
| InChIKey | CBQGZNWJOPISMK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |